C30H36N6O6 — CID 59995074
(4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4,7-bis(dimethylamino)-9-hex-1-ynyl-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 59995074) has the molecular formula C30H36N6O6 and a molecular weight of 576.65 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4,7-bis(dimethylamino)-9-hex-1-ynyl-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4,7-bis(dimethylamino)-9-hex-1-ynyl-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59995074 |
| Molecular Formula | C30H36N6O6 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4,7-bis(dimethylamino)-9-hex-1-ynyl-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CCCCC#Cc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(C#N)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@]3(N)C[C@]1(N)C2 |
| InChI | InChI=1S/C30H36N6O6/c1-6-7-8-9-10-15-11-17(35(2)3)16-12-28(33)13-30(34)24(36(4)5)23(39)19(27(32)42)25(40)29(30,14-31)26(41)20(28)22(38)18(16)21(15)37/h11,24,37-38,40H,6-8,12-13,33-34H2,1-5H3,(H2,32,42)/t24-,28-,29+,30-/m1/s1 |
| InChIKey | KMRAXFZARRLEPB-UDKDNODWSA-N |
| XLogP | 0.51 |
| TPSA | 220.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|