C32H37N7O6 — CID 59995192
(4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4,7-bis(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-9-(2-phenylethylamino)-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 59995192) has the molecular formula C32H37N7O6 and a molecular weight of 615.69 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4,7-bis(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-9-(2-phenylethylamino)-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4,7-bis(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-9-(2-phenylethylamino)-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59995192 |
| Molecular Formula | C32H37N7O6 |
| Molecular Weight | 615.69 g/mol |
| Exact Mass | 615.28 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4,7-bis(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-9-(2-phenylethylamino)-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NCCc2ccccc2)c(O)c2c1C[C@@]1(N)C[C@@]3(N)[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(C#N)C(=O)C1=C2O |
| InChI | InChI=1S/C32H37N7O6/c1-38(2)19-12-18(37-11-10-16-8-6-5-7-9-16)23(40)20-17(19)13-30(35)14-32(36)26(39(3)4)25(42)21(29(34)45)27(43)31(32,15-33)28(44)22(30)24(20)41/h5-9,12,26,37,40-41,43H,10-11,13-14,35-36H2,1-4H3,(H2,34,45)/t26-,30-,31+,32-/m1/s1 |
| InChIKey | IXSTWJKITMQMTD-KLWPZSMLSA-N |
| XLogP | 0.63 |
| TPSA | 232.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.69 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|