C28H30N6O8 — CID 59995088
methyl 3-[(5aR,6aS,7S,10aR)-5a,6a-diamino-9-carbamoyl-10a-cyano-4,7-bis(dimethylamino)-1,10,12-trihydroxy-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]prop-2-ynoate (PubChem CID 59995088) has the molecular formula C28H30N6O8 and a molecular weight of 578.58 g/mol. Its IUPAC name is methyl 3-[(5aR,6aS,7S,10aR)-5a,6a-diamino-9-carbamoyl-10a-cyano-4,7-bis(dimethylamino)-1,10,12-trihydroxy-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]prop-2-ynoate.
| Compound Name | methyl 3-[(5aR,6aS,7S,10aR)-5a,6a-diamino-9-carbamoyl-10a-cyano-4,7-bis(dimethylamino)-1,10,12-trihydroxy-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]prop-2-ynoate |
|---|---|
| PubChem CID | 59995088 |
| Molecular Formula | C28H30N6O8 |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | methyl 3-[(5aR,6aS,7S,10aR)-5a,6a-diamino-9-carbamoyl-10a-cyano-4,7-bis(dimethylamino)-1,10,12-trihydroxy-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]prop-2-ynoate |
| SMILES | COC(=O)C#Cc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(C#N)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@]3(N)C[C@]1(N)C2 |
| InChI | InChI=1S/C28H30N6O8/c1-33(2)14-8-12(6-7-15(35)42-5)19(36)16-13(14)9-26(31)10-28(32)22(34(3)4)21(38)17(25(30)41)23(39)27(28,11-29)24(40)18(26)20(16)37/h8,22,36-37,39H,9-10,31-32H2,1-5H3,(H2,30,41)/t22-,26-,27+,28-/m1/s1 |
| InChIKey | XXTCHFZTIIEMGI-HLJLCZKJSA-N |
| XLogP | -1.50 |
| TPSA | 246.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|