C32H39N3O9 — CID 140505437
butyl 3-[(5aS,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-5a,6a-dimethyl-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]prop-2-ynoate (PubChem CID 140505437) has the molecular formula C32H39N3O9 and a molecular weight of 609.68 g/mol. Its IUPAC name is butyl 3-[(5aS,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-5a,6a-dimethyl-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]prop-2-ynoate.
| Compound Name | butyl 3-[(5aS,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-5a,6a-dimethyl-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]prop-2-ynoate |
|---|---|
| PubChem CID | 140505437 |
| Molecular Formula | C32H39N3O9 |
| Molecular Weight | 609.68 g/mol |
| Exact Mass | 609.27 |
| IUPAC Name | butyl 3-[(5aS,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-5a,6a-dimethyl-8,11-dioxo-6,7-dihydro-5H-tetracen-2-yl]prop-2-ynoate |
| SMILES | CCCCOC(=O)C#Cc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@]3(C)C[C@]1(C)C2 |
| InChI | InChI=1S/C32H39N3O9/c1-8-9-12-44-19(36)11-10-16-13-18(34(4)5)17-14-30(2)15-31(3)26(35(6)7)25(39)21(29(33)42)27(40)32(31,43)28(41)22(30)24(38)20(17)23(16)37/h13,26,37-38,40,43H,8-9,12,14-15H2,1-7H3,(H2,33,42)/t26-,30+,31+,32-/m1/s1 |
| InChIKey | ADDHNHZQOWHZNF-SSHYCOHZSA-N |
| XLogP | 1.50 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.68 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|