C32H40N4O7S — CID 140505521
(4S,4aS,5aS,12aR)-4,7-bis(dimethylamino)-9-[5-[(dimethylamino)methyl]thiophen-2-yl]-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 140505521) has the molecular formula C32H40N4O7S and a molecular weight of 624.76 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-4,7-bis(dimethylamino)-9-[5-[(dimethylamino)methyl]thiophen-2-yl]-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-4,7-bis(dimethylamino)-9-[5-[(dimethylamino)methyl]thiophen-2-yl]-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505521 |
| Molecular Formula | C32H40N4O7S |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | (4S,4aS,5aS,12aR)-4,7-bis(dimethylamino)-9-[5-[(dimethylamino)methyl]thiophen-2-yl]-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)Cc1ccc(-c2cc(N(C)C)c3c(c2O)C(O)=C2C(=O)[C@]4(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@]4(C)C[C@]2(C)C3)s1 |
| InChI | InChI=1S/C32H40N4O7S/c1-30-12-17-18(35(5)6)11-16(19-10-9-15(44-19)13-34(3)4)23(37)20(17)24(38)22(30)28(41)32(43)27(40)21(29(33)42)25(39)26(36(7)8)31(32,2)14-30/h9-11,26,37-38,40,43H,12-14H2,1-8H3,(H2,33,42)/t26-,30+,31+,32-/m1/s1 |
| InChIKey | ISHMUZPQMWSUEK-SSHYCOHZSA-N |
| XLogP | 2.60 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|