C29H39N3O7 — CID 140506040
(4S,4aS,5aS,12aR)-10-butoxy-4,7-bis(dimethylamino)-1,11,12a-trihydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 140506040) has the molecular formula C29H39N3O7 and a molecular weight of 541.65 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-10-butoxy-4,7-bis(dimethylamino)-1,11,12a-trihydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-10-butoxy-4,7-bis(dimethylamino)-1,11,12a-trihydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140506040 |
| Molecular Formula | C29H39N3O7 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | (4S,4aS,5aS,12aR)-10-butoxy-4,7-bis(dimethylamino)-1,11,12a-trihydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CCCCOc1ccc(N(C)C)c2c1C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@]3(C)C[C@]1(C)C2 |
| InChI | InChI=1S/C29H39N3O7/c1-8-9-12-39-17-11-10-16(31(4)5)15-13-27(2)14-28(3)23(32(6)7)22(34)19(26(30)37)24(35)29(28,38)25(36)20(27)21(33)18(15)17/h10-11,23,33,35,38H,8-9,12-14H2,1-7H3,(H2,30,37)/t23-,27+,28+,29-/m1/s1 |
| InChIKey | YQSOHDXGSJXOTG-FQYQUSJJSA-N |
| XLogP | 2.28 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|