C34H39N3O8 — CID 140505600
(4S,4aS,5aS,12aR)-4-(dimethylamino)-7-[4-(2,2-dimethylpropanoylamino)phenyl]-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 140505600) has the molecular formula C34H39N3O8 and a molecular weight of 617.70 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-4-(dimethylamino)-7-[4-(2,2-dimethylpropanoylamino)phenyl]-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-4-(dimethylamino)-7-[4-(2,2-dimethylpropanoylamino)phenyl]-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505600 |
| Molecular Formula | C34H39N3O8 |
| Molecular Weight | 617.70 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | (4S,4aS,5aS,12aR)-4-(dimethylamino)-7-[4-(2,2-dimethylpropanoylamino)phenyl]-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(NC(=O)C(C)(C)C)cc5)c4C[C@@]3(C)C[C@@]12C |
| InChI | InChI=1S/C34H39N3O8/c1-31(2,3)30(44)36-17-10-8-16(9-11-17)18-12-13-20(38)21-19(18)14-32(4)15-33(5)26(37(6)7)25(40)22(29(35)43)27(41)34(33,45)28(42)23(32)24(21)39/h8-13,26,38-39,41,45H,14-15H2,1-7H3,(H2,35,43)(H,36,44)/t26-,32+,33+,34-/m1/s1 |
| InChIKey | OVMIOXDEKAVSQH-QWWNLRCWSA-N |
| XLogP | 3.40 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|