C31H39N3O9 — CID 140506153
3-(dimethylamino)propyl (E)-3-[(6aR,10S,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-10a,11a-dimethyl-6,9-dioxo-11,12-dihydro-10H-tetracen-1-yl]prop-2-enoate (PubChem CID 140506153) has the molecular formula C31H39N3O9 and a molecular weight of 597.67 g/mol. Its IUPAC name is 3-(dimethylamino)propyl (E)-3-[(6aR,10S,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-10a,11a-dimethyl-6,9-dioxo-11,12-dihydro-10H-tetracen-1-yl]prop-2-enoate.
| Compound Name | 3-(dimethylamino)propyl (E)-3-[(6aR,10S,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-10a,11a-dimethyl-6,9-dioxo-11,12-dihydro-10H-tetracen-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 140506153 |
| Molecular Formula | C31H39N3O9 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | 3-(dimethylamino)propyl (E)-3-[(6aR,10S,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-10a,11a-dimethyl-6,9-dioxo-11,12-dihydro-10H-tetracen-1-yl]prop-2-enoate |
| SMILES | CN(C)CCCOC(=O)/C=C/c1ccc(O)c2c1C[C@@]1(C)C[C@@]3(C)[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C31H39N3O9/c1-29-14-17-16(9-11-19(36)43-13-7-12-33(3)4)8-10-18(35)20(17)23(37)22(29)27(40)31(42)26(39)21(28(32)41)24(38)25(34(5)6)30(31,2)15-29/h8-11,25,35,37,39,42H,7,12-15H2,1-6H3,(H2,32,41)/b11-9+/t25-,29+,30+,31-/m1/s1 |
| InChIKey | HPAAGIQLEHGIJU-IGCHYWFRSA-N |
| XLogP | 1.25 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|