C29H37N3O9 — CID 140505662
2-[(6aR,10S,10aS,11aS)-3-tert-butyl-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-10a,11a-dimethyl-6,9-dioxo-11,12-dihydro-10H-tetracen-1-yl]-2-aminoacetic acid (PubChem CID 140505662) has the molecular formula C29H37N3O9 and a molecular weight of 571.63 g/mol. Its IUPAC name is 2-[(6aR,10S,10aS,11aS)-3-tert-butyl-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-10a,11a-dimethyl-6,9-dioxo-11,12-dihydro-10H-tetracen-1-yl]-2-aminoacetic acid.
| Compound Name | 2-[(6aR,10S,10aS,11aS)-3-tert-butyl-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-10a,11a-dimethyl-6,9-dioxo-11,12-dihydro-10H-tetracen-1-yl]-2-aminoacetic acid |
|---|---|
| PubChem CID | 140505662 |
| Molecular Formula | C29H37N3O9 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | 2-[(6aR,10S,10aS,11aS)-3-tert-butyl-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-10a,11a-dimethyl-6,9-dioxo-11,12-dihydro-10H-tetracen-1-yl]-2-aminoacetic acid |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(C(C)(C)C)cc(C(N)C(=O)O)c4C[C@@]3(C)C[C@@]12C |
| InChI | InChI=1S/C29H37N3O9/c1-26(2,3)13-8-11(17(30)25(39)40)12-9-27(4)10-28(5)21(32(6)7)20(35)15(24(31)38)22(36)29(28,41)23(37)16(27)19(34)14(12)18(13)33/h8,17,21,33-34,36,41H,9-10,30H2,1-7H3,(H2,31,38)(H,39,40)/t17?,21-,27+,28+,29-/m1/s1 |
| InChIKey | MLABZEGLIWULDS-MUIXHXGNSA-N |
| XLogP | 1.13 |
| TPSA | 224.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|