C28H32N2O8 — CID 140505743
(4S,4aS,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-7-[(E)-3-oxopent-1-enyl]-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 140505743) has the molecular formula C28H32N2O8 and a molecular weight of 524.57 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-7-[(E)-3-oxopent-1-enyl]-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-7-[(E)-3-oxopent-1-enyl]-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505743 |
| Molecular Formula | C28H32N2O8 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | (4S,4aS,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-7-[(E)-3-oxopent-1-enyl]-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CCC(=O)/C=C/c1ccc(O)c2c1C[C@@]1(C)C[C@@]3(C)[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H32N2O8/c1-6-14(31)9-7-13-8-10-16(32)17-15(13)11-26(2)12-27(3)22(30(4)5)21(34)18(25(29)37)23(35)28(27,38)24(36)19(26)20(17)33/h7-10,22,32-33,35,38H,6,11-12H2,1-5H3,(H2,29,37)/b9-7+/t22-,26+,27+,28-/m1/s1 |
| InChIKey | ZSHLBEATBXFGEU-WLCYMUHVSA-N |
| XLogP | 1.74 |
| TPSA | 178.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|