C32H33N3O9S — CID 140506215
(4S,4aS,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-[4-(methanesulfonamido)phenyl]ethynyl]-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 140506215) has the molecular formula C32H33N3O9S and a molecular weight of 635.70 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-[4-(methanesulfonamido)phenyl]ethynyl]-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-[4-(methanesulfonamido)phenyl]ethynyl]-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140506215 |
| Molecular Formula | C32H33N3O9S |
| Molecular Weight | 635.70 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | (4S,4aS,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-[4-(methanesulfonamido)phenyl]ethynyl]-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(C#Cc5ccc(NS(C)(=O)=O)cc5)c4C[C@@]3(C)C[C@@]12C |
| InChI | InChI=1S/C32H33N3O9S/c1-30-14-19-17(9-6-16-7-11-18(12-8-16)34-45(5,43)44)10-13-20(36)21(19)24(37)23(30)28(40)32(42)27(39)22(29(33)41)25(38)26(35(3)4)31(32,2)15-30/h7-8,10-13,26,34,36-37,39,42H,14-15H2,1-5H3,(H2,33,41)/t26-,30+,31+,32-/m1/s1 |
| InChIKey | XHBRAQZJIANRNK-SSHYCOHZSA-N |
| XLogP | 1.52 |
| TPSA | 207.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.70 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|