C33H35N3O8 — CID 140505564
(4S,4aS,5aS,12aR)-7-[4-(cyclopropanecarbonylamino)phenyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 140505564) has the molecular formula C33H35N3O8 and a molecular weight of 601.66 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-7-[4-(cyclopropanecarbonylamino)phenyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-7-[4-(cyclopropanecarbonylamino)phenyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505564 |
| Molecular Formula | C33H35N3O8 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | (4S,4aS,5aS,12aR)-7-[4-(cyclopropanecarbonylamino)phenyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(NC(=O)C6CC6)cc5)c4C[C@@]3(C)C[C@@]12C |
| InChI | InChI=1S/C33H35N3O8/c1-31-13-19-18(15-7-9-17(10-8-15)35-30(43)16-5-6-16)11-12-20(37)21(19)24(38)23(31)28(41)33(44)27(40)22(29(34)42)25(39)26(36(3)4)32(33,2)14-31/h7-12,16,26,37-38,40,44H,5-6,13-14H2,1-4H3,(H2,34,42)(H,35,43)/t26-,31+,32+,33-/m1/s1 |
| InChIKey | WCPKVHYNHCXOTC-RVLOQZQWSA-N |
| XLogP | 2.76 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|