C27H25BN2O9 — CID 88935208
CID 88935208 (PubChem CID 88935208) has the molecular formula C27H25BN2O9 and a molecular weight of 532.31 g/mol.
| Compound Name | CID 88935208 |
|---|---|
| PubChem CID | 88935208 |
| Molecular Formula | C27H25BN2O9 |
| Molecular Weight | 532.31 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | — |
| SMILES | [B][C@@]12Cc3ccc(-c4occc4C=O)c(O)c3C(O)=C1C(=O)[C@]1(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@]1(C)C2 |
| InChI | InChI=1S/C27H25BN2O9/c1-25-10-26(28)8-11-4-5-13(20-12(9-31)6-7-39-20)17(32)14(11)18(33)16(26)23(36)27(25,38)22(35)15(24(29)37)19(34)21(25)30(2)3/h4-7,9,21,32-33,35,38H,8,10H2,1-3H3,(H2,29,37)/t21-,25+,26-,27-/m1/s1 |
| InChIKey | IBQCGVXEBJONIT-CNVJREJJSA-N |
| XLogP | 1.14 |
| TPSA | 191.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|