C30H30F2IN3O7 — CID 163836968
(4S,4aS,5aR,12aR)-9-(2,4-difluorophenyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-5a-iodo-4a-methyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 163836968) has the molecular formula C30H30F2IN3O7 and a molecular weight of 709.48 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-9-(2,4-difluorophenyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-5a-iodo-4a-methyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-9-(2,4-difluorophenyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-5a-iodo-4a-methyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 163836968 |
| Molecular Formula | C30H30F2IN3O7 |
| Molecular Weight | 709.48 g/mol |
| Exact Mass | 709.11 |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-(2,4-difluorophenyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-5a-iodo-4a-methyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(-c2ccc(F)cc2F)c(O)c2c1C[C@@]1(I)C[C@@]3(C)[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C30H30F2IN3O7/c1-28-11-29(33)10-15-17(35(2)3)9-14(13-7-6-12(31)8-16(13)32)21(37)18(15)22(38)20(29)26(41)30(28,43)25(40)19(27(34)42)23(39)24(28)36(4)5/h6-9,24,37-38,40,43H,10-11H2,1-5H3,(H2,34,42)/t24-,28+,29-,30-/m1/s1 |
| InChIKey | RJZYFUVRAJLBCQ-XVVVQISBSA-N |
| XLogP | 2.92 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|