C30H31F2N3O7 — CID 54681007
9-(2,4-difluorophenyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-N-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54681007) has the molecular formula C30H31F2N3O7 and a molecular weight of 583.59 g/mol. Its IUPAC name is 9-(2,4-difluorophenyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-N-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 9-(2,4-difluorophenyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-N-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54681007 |
| Molecular Formula | C30H31F2N3O7 |
| Molecular Weight | 583.59 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | 9-(2,4-difluorophenyl)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-N-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CNC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)c(-c5ccc(F)cc5F)cc(N(C)C)c4CC3CC2C(N(C)C)C1=O |
| InChI | InChI=1S/C30H31F2N3O7/c1-33-29(41)22-26(38)23(35(4)5)17-9-12-8-16-19(34(2)3)11-15(14-7-6-13(31)10-18(14)32)24(36)21(16)25(37)20(12)27(39)30(17,42)28(22)40/h6-7,10-12,17,23,36-37,40,42H,8-9H2,1-5H3,(H,33,41) |
| InChIKey | LUXUEXMOBMBSKY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 150.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.59 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|