C35H52N4O7 — CID 140505542
(4S,4aS,5aS,12aR)-4-(dimethylamino)-7,9-bis[(2,2-dimethylpropylamino)methyl]-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 140505542) has the molecular formula C35H52N4O7 and a molecular weight of 640.82 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-4-(dimethylamino)-7,9-bis[(2,2-dimethylpropylamino)methyl]-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-4-(dimethylamino)-7,9-bis[(2,2-dimethylpropylamino)methyl]-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505542 |
| Molecular Formula | C35H52N4O7 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | (4S,4aS,5aS,12aR)-4-(dimethylamino)-7,9-bis[(2,2-dimethylpropylamino)methyl]-1,10,11,12a-tetrahydroxy-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(CNCC(C)(C)C)cc(CNCC(C)(C)C)c4C[C@@]3(C)C[C@@]12C |
| InChI | InChI=1S/C35H52N4O7/c1-31(2,3)16-37-13-18-11-19(14-38-17-32(4,5)6)24(40)21-20(18)12-33(7)15-34(8)27(39(9)10)26(42)22(30(36)45)28(43)35(34,46)29(44)23(33)25(21)41/h11,27,37-38,40-41,43,46H,12-17H2,1-10H3,(H2,36,45)/t27-,33+,34+,35-/m1/s1 |
| InChIKey | MRCJPGZKPPPCJJ-QFBSZDFWSA-N |
| XLogP | 3.02 |
| TPSA | 185.45 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|