C35H41N3O8 — CID 140505927
(4S,4aS,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 140505927) has the molecular formula C35H41N3O8 and a molecular weight of 631.73 g/mol. Its IUPAC name is (4S,4aS,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505927 |
| Molecular Formula | C35H41N3O8 |
| Molecular Weight | 631.73 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | (4S,4aS,5aS,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-methoxy-5-(pyrrolidin-1-ylmethyl)phenyl]-4a,5a-dimethyl-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | COc1ccc(CN2CCCC2)cc1-c1ccc(O)c2c1C[C@@]1(C)C[C@@]3(C)[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C35H41N3O8/c1-33-15-21-19(20-14-18(8-11-23(20)46-5)16-38-12-6-7-13-38)9-10-22(39)24(21)27(40)26(33)31(43)35(45)30(42)25(32(36)44)28(41)29(37(3)4)34(35,2)17-33/h8-11,14,29,39-40,42,45H,6-7,12-13,15-17H2,1-5H3,(H2,36,44)/t29-,33+,34+,35-/m1/s1 |
| InChIKey | VCDURWILZCRQBN-OGICNVKRSA-N |
| XLogP | 3.02 |
| TPSA | 173.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.73 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|