C30H28ClN5O6 — CID 59995505
(4S,4aS,5aR,12aR)-4a,5a-diamino-7-[(E)-2-(4-chlorophenyl)ethenyl]-12a-cyano-4-(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 59995505) has the molecular formula C30H28ClN5O6 and a molecular weight of 590.04 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4a,5a-diamino-7-[(E)-2-(4-chlorophenyl)ethenyl]-12a-cyano-4-(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4a,5a-diamino-7-[(E)-2-(4-chlorophenyl)ethenyl]-12a-cyano-4-(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59995505 |
| Molecular Formula | C30H28ClN5O6 |
| Molecular Weight | 590.04 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4a,5a-diamino-7-[(E)-2-(4-chlorophenyl)ethenyl]-12a-cyano-4-(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(C#N)C(=O)C3=C(O)c4c(O)ccc(/C=C/c5ccc(Cl)cc5)c4C[C@@]3(N)C[C@@]12N |
| InChI | InChI=1S/C30H28ClN5O6/c1-36(2)24-23(39)20(27(33)42)25(40)29(13-32)26(41)21-22(38)19-17(11-28(21,34)12-30(24,29)35)15(7-10-18(19)37)6-3-14-4-8-16(31)9-5-14/h3-10,24,37-38,40H,11-12,34-35H2,1-2H3,(H2,33,42)/b6-3+/t24-,28-,29+,30-/m1/s1 |
| InChIKey | YYFWOTCUSPWAJO-YHDCZWKSSA-N |
| XLogP | 1.73 |
| TPSA | 216.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.04 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|