C27H27N5O6S — CID 59995458
(4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4-(dimethylamino)-1,10,11-trihydroxy-7-(5-methylthiophen-2-yl)-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 59995458) has the molecular formula C27H27N5O6S and a molecular weight of 549.61 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4-(dimethylamino)-1,10,11-trihydroxy-7-(5-methylthiophen-2-yl)-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4-(dimethylamino)-1,10,11-trihydroxy-7-(5-methylthiophen-2-yl)-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59995458 |
| Molecular Formula | C27H27N5O6S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4-(dimethylamino)-1,10,11-trihydroxy-7-(5-methylthiophen-2-yl)-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(O)c3c2C[C@@]2(N)C[C@@]4(N)[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(C#N)C(=O)C2=C3O)s1 |
| InChI | InChI=1S/C27H27N5O6S/c1-11-4-7-15(39-11)12-5-6-14(33)16-13(12)8-25(30)9-27(31)21(32(2)3)20(35)17(24(29)38)22(36)26(27,10-28)23(37)18(25)19(16)34/h4-7,21,33-34,36H,8-9,30-31H2,1-3H3,(H2,29,38)/t21-,25-,26+,27-/m1/s1 |
| InChIKey | QGJAUJGBSPKYAM-ORZNUPDKSA-N |
| XLogP | 0.94 |
| TPSA | 216.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|