C32H33N7O6 — CID 59995291
(4S,4aS,5aR,12aR)-4a,5a-diamino-9-[2-(4-aminophenyl)ethynyl]-12a-cyano-4,7-bis(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 59995291) has the molecular formula C32H33N7O6 and a molecular weight of 611.66 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4a,5a-diamino-9-[2-(4-aminophenyl)ethynyl]-12a-cyano-4,7-bis(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4a,5a-diamino-9-[2-(4-aminophenyl)ethynyl]-12a-cyano-4,7-bis(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59995291 |
| Molecular Formula | C32H33N7O6 |
| Molecular Weight | 611.66 g/mol |
| Exact Mass | 611.25 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4a,5a-diamino-9-[2-(4-aminophenyl)ethynyl]-12a-cyano-4,7-bis(dimethylamino)-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(C#Cc2ccc(N)cc2)c(O)c2c1C[C@@]1(N)C[C@@]3(N)[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(C#N)C(=O)C1=C2O |
| InChI | InChI=1S/C32H33N7O6/c1-38(2)19-11-16(8-5-15-6-9-17(34)10-7-15)23(40)20-18(19)12-30(36)13-32(37)26(39(3)4)25(42)21(29(35)45)27(43)31(32,14-33)28(44)22(30)24(20)41/h6-7,9-11,26,40-41,43H,12-13,34,36-37H2,1-4H3,(H2,35,45)/t26-,30-,31+,32-/m1/s1 |
| InChIKey | OXTROLDDSHXZEN-KLWPZSMLSA-N |
| XLogP | -0.05 |
| TPSA | 246.25 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.66 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|