C28H33N5O7 — CID 59995451
(4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4-(dimethylamino)-7-hexanoyl-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide (PubChem CID 59995451) has the molecular formula C28H33N5O7 and a molecular weight of 551.60 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4-(dimethylamino)-7-hexanoyl-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4-(dimethylamino)-7-hexanoyl-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59995451 |
| Molecular Formula | C28H33N5O7 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4a,5a-diamino-12a-cyano-4-(dimethylamino)-7-hexanoyl-1,10,11-trihydroxy-3,12-dioxo-5,6-dihydro-4H-tetracene-2-carboxamide |
| SMILES | CCCCCC(=O)c1ccc(O)c2c1C[C@@]1(N)C[C@@]3(N)[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(C#N)C(=O)C1=C2O |
| InChI | InChI=1S/C28H33N5O7/c1-4-5-6-7-15(34)13-8-9-16(35)17-14(13)10-26(31)11-28(32)22(33(2)3)21(37)18(25(30)40)23(38)27(28,12-29)24(39)19(26)20(17)36/h8-9,22,35-36,38H,4-7,10-11,31-32H2,1-3H3,(H2,30,40)/t22-,26-,27+,28-/m1/s1 |
| InChIKey | NAMMOOKWUDDFSK-HLJLCZKJSA-N |
| XLogP | 0.67 |
| TPSA | 234.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|