C18H24N4O3 — CID 88961048
5-amino-N-cyclohexyl-1-[3-(methylperoxymethyl)phenyl]pyrazole-4-carboxamide (PubChem CID 88961048) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 5-amino-N-cyclohexyl-1-[3-(methylperoxymethyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-N-cyclohexyl-1-[3-(methylperoxymethyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 88961048 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 5-amino-N-cyclohexyl-1-[3-(methylperoxymethyl)phenyl]pyrazole-4-carboxamide |
| SMILES | COOCc1cccc(-n2ncc(C(=O)NC3CCCCC3)c2N)c1 |
| InChI | InChI=1S/C18H24N4O3/c1-24-25-12-13-6-5-9-15(10-13)22-17(19)16(11-20-22)18(23)21-14-7-3-2-4-8-14/h5-6,9-11,14H,2-4,7-8,12,19H2,1H3,(H,21,23) |
| InChIKey | OPCYBWSDOUALEL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|