About 2-(1-iodoethenyl)phenol
2-(1-iodoethenyl)phenol (PubChem CID 88963209) has the molecular formula C8H7IO
and a molecular weight of 246.05 g/mol. Its IUPAC name is 2-(1-iodoethenyl)phenol.
Molecular Properties
| Compound Name | 2-(1-iodoethenyl)phenol |
| PubChem CID | 88963209 |
| Molecular Formula | C8H7IO |
| Molecular Weight | 246.05 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | 2-(1-iodoethenyl)phenol |
| SMILES | C=C(I)c1ccccc1O |
| InChI | InChI=1S/C8H7IO/c1-6(9)7-4-2-3-5-8(7)10/h2-5,10H,1H2 |
| InChIKey | KEUAYFFZIUKBQZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.05 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-iodoethenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-iodoethenyl)phenol?
The IUPAC name of 2-(1-iodoethenyl)phenol (CID 88963209) is 2-(1-iodoethenyl)phenol.
What is the SMILES notation for 2-(1-iodoethenyl)phenol?
The canonical SMILES for 2-(1-iodoethenyl)phenol is C=C(I)c1ccccc1O.
What is the InChIKey of 2-(1-iodoethenyl)phenol?
The InChIKey is KEUAYFFZIUKBQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IO/c1-6(9)7-4-2-3-5-8(7)10/h2-5,10H,1H2.
What are the key properties of 2-(1-iodoethenyl)phenol?
2-(1-iodoethenyl)phenol has a molecular weight of 246.05 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-iodoethenyl)phenol is sourced from PubChem (CID 88963209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).