C15H26IN3O3 — CID 88964351
methyl N-[(2S)-1-[[1-[(1-iodoethenylamino)methyl]cyclopentyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 88964351) has the molecular formula C15H26IN3O3 and a molecular weight of 423.30 g/mol. Its IUPAC name is methyl N-[(2S)-1-[[1-[(1-iodoethenylamino)methyl]cyclopentyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[[1-[(1-iodoethenylamino)methyl]cyclopentyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 88964351 |
| Molecular Formula | C15H26IN3O3 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | methyl N-[(2S)-1-[[1-[(1-iodoethenylamino)methyl]cyclopentyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | C=C(I)NCC1(NC(=O)[C@@H](NC(=O)OC)C(C)C)CCCC1 |
| InChI | InChI=1S/C15H26IN3O3/c1-10(2)12(18-14(21)22-4)13(20)19-15(7-5-6-8-15)9-17-11(3)16/h10,12,17H,3,5-9H2,1-2,4H3,(H,18,21)(H,19,20)/t12-/m0/s1 |
| InChIKey | AKHFZANTMCQGPX-LBPRGKRZSA-N |
| XLogP | 2.29 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|