C13H17NO6 — CID 88964794
2-(hydroxymethyl)-6-(4-methanimidoylphenoxy)oxane-3,4,5-triol (PubChem CID 88964794) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-(4-methanimidoylphenoxy)oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-(4-methanimidoylphenoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 88964794 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-(hydroxymethyl)-6-(4-methanimidoylphenoxy)oxane-3,4,5-triol |
| SMILES | [H]/N=C/c1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C13H17NO6/c14-5-7-1-3-8(4-2-7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-5,9-18H,6H2/b14-5+ |
| InChIKey | GQJXZXHXJDOOFP-LHHJGKSTSA-N |
| XLogP | -1.14 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|