C19H21N7 — CID 88967228
2-N-(4-aminophenyl)-4-N-[4-[(Z)-hydrazinylidenemethyl]-2,6-dimethylphenyl]pyrimidine-2,4-diamine (PubChem CID 88967228) has the molecular formula C19H21N7 and a molecular weight of 347.43 g/mol. Its IUPAC name is 2-N-(4-aminophenyl)-4-N-[4-[(Z)-hydrazinylidenemethyl]-2,6-dimethylphenyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-aminophenyl)-4-N-[4-[(Z)-hydrazinylidenemethyl]-2,6-dimethylphenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 88967228 |
| Molecular Formula | C19H21N7 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-N-(4-aminophenyl)-4-N-[4-[(Z)-hydrazinylidenemethyl]-2,6-dimethylphenyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cc(/C=N\N)cc(C)c1Nc1ccnc(Nc2ccc(N)cc2)n1 |
| InChI | InChI=1S/C19H21N7/c1-12-9-14(11-23-21)10-13(2)18(12)25-17-7-8-22-19(26-17)24-16-5-3-15(20)4-6-16/h3-11H,20-21H2,1-2H3,(H2,22,24,25,26)/b23-11- |
| InChIKey | DCPZCOQYMNYLLL-KSEXSDGBSA-N |
| XLogP | 3.46 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|