C15H17BN4O — CID 88967564
CID 88967564 (PubChem CID 88967564) has the molecular formula C15H17BN4O and a molecular weight of 280.14 g/mol.
| Compound Name | CID 88967564 |
|---|---|
| PubChem CID | 88967564 |
| Molecular Formula | C15H17BN4O |
| Molecular Weight | 280.14 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N2CC[C@H](NC(=O)[C@@H]3CCN3)C2)c(C#N)c1 |
| InChI | InChI=1S/C15H17BN4O/c16-11-1-2-14(10(7-11)8-17)20-6-4-12(9-20)19-15(21)13-3-5-18-13/h1-2,7,12-13,18H,3-6,9H2,(H,19,21)/t12-,13-/m0/s1 |
| InChIKey | AHTWKPLEUALKAA-STQMWFEESA-N |
| XLogP | -0.59 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.14 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|