C13H20N6O4 — CID 88970951
(2S)-2-[[3-(diaminomethylideneamino)-2-(hydroxyamino)propanoyl]amino]-3-(4-hydroxyphenyl)propanamide (PubChem CID 88970951) has the molecular formula C13H20N6O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is (2S)-2-[[3-(diaminomethylideneamino)-2-(hydroxyamino)propanoyl]amino]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2S)-2-[[3-(diaminomethylideneamino)-2-(hydroxyamino)propanoyl]amino]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 88970951 |
| Molecular Formula | C13H20N6O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2S)-2-[[3-(diaminomethylideneamino)-2-(hydroxyamino)propanoyl]amino]-3-(4-hydroxyphenyl)propanamide |
| SMILES | NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)C(CN=C(N)N)NO |
| InChI | InChI=1S/C13H20N6O4/c14-11(21)9(5-7-1-3-8(20)4-2-7)18-12(22)10(19-23)6-17-13(15)16/h1-4,9-10,19-20,23H,5-6H2,(H2,14,21)(H,18,22)(H4,15,16,17)/t9-,10?/m0/s1 |
| InChIKey | VDPQWUWVPKDZHJ-RGURZIINSA-N |
| XLogP | -2.47 |
| TPSA | 189.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|