About CID 88971683
CID 88971683 (PubChem CID 88971683) has the molecular formula C30H36O9
and a molecular weight of 540.61 g/mol.
Molecular Properties
| Compound Name | CID 88971683 |
| PubChem CID | 88971683 |
| Molecular Formula | C30H36O9 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)OC[C@H]1O[C@@H]2OC3(O[C@H]2[C@H]2OC4(O[C@@H]21)C1CC2CC(C1)C(=O)C4C2)C1CC2CC(C1)C(=O)C3C2 |
| InChI | InChI=1S/C30H36O9/c1-12(2)27(33)34-11-21-24-25(37-29(36-24)17-5-13-3-15(9-17)22(31)19(29)7-13)26-28(35-21)39-30(38-26)18-6-14-4-16(10-18)23(32)20(30)8-14/h13-21,24-26,28H,1,3-11H2,2H3/t13?,14?,15?,16?,17?,18?,19?,20?,21-,24-,25+,26+,28-,29?,30?/m1/s1 |
| InChIKey | VHDUXONBRSDGFO-RASLBACISA-N |
| XLogP | 2.69 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 88971683 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88971683?
The IUPAC name of CID 88971683 (CID 88971683) is not available.
What is the SMILES notation for CID 88971683?
The canonical SMILES for CID 88971683 is C=C(C)C(=O)OC[C@H]1O[C@@H]2OC3(O[C@H]2[C@H]2OC4(O[C@@H]21)C1CC2CC(C1)C(=O)C4C2)C1CC2CC(C1)C(=O)C3C2.
What is the InChIKey of CID 88971683?
The InChIKey is VHDUXONBRSDGFO-RASLBACISA-N. The full InChI is InChI=1S/C30H36O9/c1-12(2)27(33)34-11-21-24-25(37-29(36-24)17-5-13-3-15(9-17)22(31)19(29)7-13)26-28(35-21)39-30(38-26)18-6-14-4-16(10-18)23(32)20(30)8-14/h13-21,24-26,28H,1,3-11H2,2H3/t13?,14?,15?,16?,17?,18?,19?,20?,21-,24-,25+,26+,28-,29?,30?/m1/s1.
What are the key properties of CID 88971683?
CID 88971683 has a molecular weight of 540.61 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88971683 is sourced from PubChem (CID 88971683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).