C30H36O9 — CID 88971683
CID 88971683 (PubChem CID 88971683) has the molecular formula C30H36O9 and a molecular weight of 540.61 g/mol.
| Compound Name | CID 88971683 |
|---|---|
| PubChem CID | 88971683 |
| Molecular Formula | C30H36O9 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)OC[C@H]1O[C@@H]2OC3(O[C@H]2[C@H]2OC4(O[C@@H]21)C1CC2CC(C1)C(=O)C4C2)C1CC2CC(C1)C(=O)C3C2 |
| InChI | InChI=1S/C30H36O9/c1-12(2)27(33)34-11-21-24-25(37-29(36-24)17-5-13-3-15(9-17)22(31)19(29)7-13)26-28(35-21)39-30(38-26)18-6-14-4-16(10-18)23(32)20(30)8-14/h13-21,24-26,28H,1,3-11H2,2H3/t13?,14?,15?,16?,17?,18?,19?,20?,21-,24-,25+,26+,28-,29?,30?/m1/s1 |
| InChIKey | VHDUXONBRSDGFO-RASLBACISA-N |
| XLogP | 2.69 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|