C21H33NO — CID 88971947
11-(N-propan-2-ylanilino)dodeca-1,11-dien-2-ol (PubChem CID 88971947) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is 11-(N-propan-2-ylanilino)dodeca-1,11-dien-2-ol.
| Compound Name | 11-(N-propan-2-ylanilino)dodeca-1,11-dien-2-ol |
|---|---|
| PubChem CID | 88971947 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | 11-(N-propan-2-ylanilino)dodeca-1,11-dien-2-ol |
| SMILES | C=C(O)CCCCCCCCC(=C)N(c1ccccc1)C(C)C |
| InChI | InChI=1S/C21H33NO/c1-18(2)22(21-16-12-9-13-17-21)19(3)14-10-7-5-6-8-11-15-20(4)23/h9,12-13,16-18,23H,3-8,10-11,14-15H2,1-2H3 |
| InChIKey | GHXUVAISYZSZCK-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|