C10H16O — CID 88974948
(1R,3Z)-4-methylidene-3-propylidenecyclohexan-1-ol (PubChem CID 88974948) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (1R,3Z)-4-methylidene-3-propylidenecyclohexan-1-ol.
| Compound Name | (1R,3Z)-4-methylidene-3-propylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 88974948 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (1R,3Z)-4-methylidene-3-propylidenecyclohexan-1-ol |
| SMILES | C=C1CC[C@@H](O)C/C1=C/CC |
| InChI | InChI=1S/C10H16O/c1-3-4-9-7-10(11)6-5-8(9)2/h4,10-11H,2-3,5-7H2,1H3/b9-4-/t10-/m1/s1 |
| InChIKey | AZUMZITXYPVAGZ-ZUYFITGHSA-N |
| XLogP | 2.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |