C9H15OP — CID 131966555
(1S,3Z)-4-methylidene-3-(2-phosphanylethylidene)cyclohexan-1-ol (PubChem CID 131966555) has the molecular formula C9H15OP and a molecular weight of 170.19 g/mol. Its IUPAC name is (1S,3Z)-4-methylidene-3-(2-phosphanylethylidene)cyclohexan-1-ol.
| Compound Name | (1S,3Z)-4-methylidene-3-(2-phosphanylethylidene)cyclohexan-1-ol |
|---|---|
| PubChem CID | 131966555 |
| Molecular Formula | C9H15OP |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (1S,3Z)-4-methylidene-3-(2-phosphanylethylidene)cyclohexan-1-ol |
| SMILES | C=C1CC[C@H](O)C/C1=C/CP |
| InChI | InChI=1S/C9H15OP/c1-7-2-3-9(10)6-8(7)4-5-11/h4,9-10H,1-3,5-6,11H2/b8-4-/t9-/m0/s1 |
| InChIKey | SAQMHSVJJACSIB-OTOXVQDCSA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|