C9H15O2P — CID 88564570
(5Z)-4-methylidene-5-(2-phosphanylethylidene)cyclohexane-1,3-diol (PubChem CID 88564570) has the molecular formula C9H15O2P and a molecular weight of 186.19 g/mol. Its IUPAC name is (5Z)-4-methylidene-5-(2-phosphanylethylidene)cyclohexane-1,3-diol.
| Compound Name | (5Z)-4-methylidene-5-(2-phosphanylethylidene)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 88564570 |
| Molecular Formula | C9H15O2P |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | (5Z)-4-methylidene-5-(2-phosphanylethylidene)cyclohexane-1,3-diol |
| SMILES | C=C1/C(=C\CP)CC(O)CC1O |
| InChI | InChI=1S/C9H15O2P/c1-6-7(2-3-12)4-8(10)5-9(6)11/h2,8-11H,1,3-5,12H2/b7-2- |
| InChIKey | HMHROBXTLHJOOZ-UQCOIBPSSA-N |
| XLogP | 0.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|