C9H14FP — CID 143208881
[(2Z)-2-[(3S)-3-fluoro-2-methylidenecyclohexylidene]ethyl]phosphane (PubChem CID 143208881) has the molecular formula C9H14FP and a molecular weight of 172.18 g/mol. Its IUPAC name is [(2Z)-2-[(3S)-3-fluoro-2-methylidenecyclohexylidene]ethyl]phosphane.
| Compound Name | [(2Z)-2-[(3S)-3-fluoro-2-methylidenecyclohexylidene]ethyl]phosphane |
|---|---|
| PubChem CID | 143208881 |
| Molecular Formula | C9H14FP |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | [(2Z)-2-[(3S)-3-fluoro-2-methylidenecyclohexylidene]ethyl]phosphane |
| SMILES | C=C1/C(=C\CP)CCC[C@@H]1F |
| InChI | InChI=1S/C9H14FP/c1-7-8(5-6-11)3-2-4-9(7)10/h5,9H,1-4,6,11H2/b8-5-/t9-/m0/s1 |
| InChIKey | STBUXTWUXRVJDL-RDOCRHDPSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|