C9H12ClFO — CID 89090716
(3Z,5S)-3-(2-chloroethylidene)-5-fluoro-4-methylidenecyclohexan-1-ol (PubChem CID 89090716) has the molecular formula C9H12ClFO and a molecular weight of 190.64 g/mol. Its IUPAC name is (3Z,5S)-3-(2-chloroethylidene)-5-fluoro-4-methylidenecyclohexan-1-ol.
| Compound Name | (3Z,5S)-3-(2-chloroethylidene)-5-fluoro-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 89090716 |
| Molecular Formula | C9H12ClFO |
| Molecular Weight | 190.64 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (3Z,5S)-3-(2-chloroethylidene)-5-fluoro-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1/C(=C\CCl)CC(O)C[C@@H]1F |
| InChI | InChI=1S/C9H12ClFO/c1-6-7(2-3-10)4-8(12)5-9(6)11/h2,8-9,12H,1,3-5H2/b7-2-/t8?,9-/m0/s1 |
| InChIKey | MKMRONONGFFFDI-NCKGKUFZSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.64 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|