C22H35ClO — CID 159399391
(2E)-2-[(3S,5S)-3,5-dimethyl-2-methylidenecyclohexylidene]ethanol;trans-(1E,3S,5S)-1-(2-chloroethylidene)-3,5-dimethyl-2-methylidenecyclohexane (PubChem CID 159399391) has the molecular formula C22H35ClO and a molecular weight of 350.97 g/mol. Its IUPAC name is (2E)-2-[(3S,5S)-3,5-dimethyl-2-methylidenecyclohexylidene]ethanol;trans-(1E,3S,5S)-1-(2-chloroethylidene)-3,5-dimethyl-2-methylidenecyclohexane.
| Compound Name | (2E)-2-[(3S,5S)-3,5-dimethyl-2-methylidenecyclohexylidene]ethanol;trans-(1E,3S,5S)-1-(2-chloroethylidene)-3,5-dimethyl-2-methylidenecyclohexane |
|---|---|
| PubChem CID | 159399391 |
| Molecular Formula | C22H35ClO |
| Molecular Weight | 350.97 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (2E)-2-[(3S,5S)-3,5-dimethyl-2-methylidenecyclohexylidene]ethanol;trans-(1E,3S,5S)-1-(2-chloroethylidene)-3,5-dimethyl-2-methylidenecyclohexane |
| SMILES | C=C1/C(=C/CCl)C[C@@H](C)C[C@@H]1C.C=C1/C(=C/CO)C[C@@H](C)C[C@@H]1C |
| InChI | InChI=1S/C11H17Cl.C11H18O/c2*1-8-6-9(2)10(3)11(7-8)4-5-12/h4,8-9H,3,5-7H2,1-2H3;4,8-9,12H,3,5-7H2,1-2H3/b2*11-4+/t2*8-,9-/m00/s1 |
| InChIKey | LNDKKVWNLCWSNJ-XXCHNHOASA-N |
| XLogP | 6.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.97 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|