C15H22O — CID 171377836
(3E)-3-(2-cyclohexylideneethylidene)-4-methylidenecyclohexan-1-ol (PubChem CID 171377836) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (3E)-3-(2-cyclohexylideneethylidene)-4-methylidenecyclohexan-1-ol.
| Compound Name | (3E)-3-(2-cyclohexylideneethylidene)-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 171377836 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (3E)-3-(2-cyclohexylideneethylidene)-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CCC(O)C/C1=C\C=C1CCCCC1 |
| InChI | InChI=1S/C15H22O/c1-12-7-10-15(16)11-14(12)9-8-13-5-3-2-4-6-13/h8-9,15-16H,1-7,10-11H2/b14-9+ |
| InChIKey | CSTPOUSWHOWTOR-NTEUORMPSA-N |
| XLogP | 3.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |