C41H26F6N4O2 — CID 88983143
5-methyl-2-[3-[7-[3-(5-methyl-6,7-dihydro-[1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-9,9-bis(trifluoromethyl)fluoren-2-yl]phenyl]-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 88983143) has the molecular formula C41H26F6N4O2 and a molecular weight of 720.67 g/mol. Its IUPAC name is 5-methyl-2-[3-[7-[3-(5-methyl-6,7-dihydro-[1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-9,9-bis(trifluoromethyl)fluoren-2-yl]phenyl]-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 5-methyl-2-[3-[7-[3-(5-methyl-6,7-dihydro-[1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-9,9-bis(trifluoromethyl)fluoren-2-yl]phenyl]-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 88983143 |
| Molecular Formula | C41H26F6N4O2 |
| Molecular Weight | 720.67 g/mol |
| Exact Mass | 720.20 |
| IUPAC Name | 5-methyl-2-[3-[7-[3-(5-methyl-6,7-dihydro-[1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-9,9-bis(trifluoromethyl)fluoren-2-yl]phenyl]-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | CC1=Nc2nc(-c3cccc(-c4ccc5c(c4)C(C(F)(F)F)(C(F)(F)F)c4cc(-c6cccc(-c7nc8nc(C)ccc8o7)c6)ccc4-5)c3)oc2CC1 |
| InChI | InChI=1S/C41H26F6N4O2/c1-21-9-15-33-35(48-21)50-37(52-33)27-7-3-5-23(17-27)25-11-13-29-30-14-12-26(20-32(30)39(31(29)19-25,40(42,43)44)41(45,46)47)24-6-4-8-28(18-24)38-51-36-34(53-38)16-10-22(2)49-36/h3-9,11-15,17-20H,10,16H2,1-2H3 |
| InChIKey | VUGIIGYKCHIYRP-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 77.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.67 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |