C17H32O5 — CID 88983185
ethyl (4R,5S,6S)-7-butoxy-5-hydroxy-2,2,4,6-tetramethyl-3-oxoheptanoate (PubChem CID 88983185) has the molecular formula C17H32O5 and a molecular weight of 316.44 g/mol. Its IUPAC name is ethyl (4R,5S,6S)-7-butoxy-5-hydroxy-2,2,4,6-tetramethyl-3-oxoheptanoate.
| Compound Name | ethyl (4R,5S,6S)-7-butoxy-5-hydroxy-2,2,4,6-tetramethyl-3-oxoheptanoate |
|---|---|
| PubChem CID | 88983185 |
| Molecular Formula | C17H32O5 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | ethyl (4R,5S,6S)-7-butoxy-5-hydroxy-2,2,4,6-tetramethyl-3-oxoheptanoate |
| SMILES | CCCCOC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)C(=O)OCC |
| InChI | InChI=1S/C17H32O5/c1-7-9-10-21-11-12(3)14(18)13(4)15(19)17(5,6)16(20)22-8-2/h12-14,18H,7-11H2,1-6H3/t12-,13+,14-/m0/s1 |
| InChIKey | HEAFLVDNYNLRCW-MJBXVCDLSA-N |
| XLogP | 2.59 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|