C10H12N2 — CID 88987664
3-(3,4-dihydropyridin-5-yl)-2,3-dihydropyridine (PubChem CID 88987664) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-(3,4-dihydropyridin-5-yl)-2,3-dihydropyridine.
| Compound Name | 3-(3,4-dihydropyridin-5-yl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 88987664 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-(3,4-dihydropyridin-5-yl)-2,3-dihydropyridine |
| SMILES | C1=CC(C2=CN=CCC2)CN=C1 |
| InChI | InChI=1S/C10H12N2/c1-3-9(7-11-5-1)10-4-2-6-12-8-10/h1,3,5-6,8-9H,2,4,7H2 |
| InChIKey | SBODCZZRIWOPDW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |