About 4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole
4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole (PubChem CID 88990099) has the molecular formula C17H17Cl2N
and a molecular weight of 306.24 g/mol. Its IUPAC name is 4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole.
Molecular Properties
| Compound Name | 4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole |
| PubChem CID | 88990099 |
| Molecular Formula | C17H17Cl2N |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole |
| SMILES | ClCC[C@@H](c1ccccc1)N1CCc2c(Cl)cccc21 |
| InChI | InChI=1S/C17H17Cl2N/c18-11-9-16(13-5-2-1-3-6-13)20-12-10-14-15(19)7-4-8-17(14)20/h1-8,16H,9-12H2/t16-/m0/s1 |
| InChIKey | JFJRTTQXEKZQRQ-INIZCTEOSA-N |
| XLogP | 5.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole?
The IUPAC name of 4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole (CID 88990099) is 4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole.
What is the SMILES notation for 4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole?
The canonical SMILES for 4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole is ClCC[C@@H](c1ccccc1)N1CCc2c(Cl)cccc21.
What is the InChIKey of 4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole?
The InChIKey is JFJRTTQXEKZQRQ-INIZCTEOSA-N. The full InChI is InChI=1S/C17H17Cl2N/c18-11-9-16(13-5-2-1-3-6-13)20-12-10-14-15(19)7-4-8-17(14)20/h1-8,16H,9-12H2/t16-/m0/s1.
What are the key properties of 4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole?
4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole has a molecular weight of 306.24 g/mol, XLogP of 5.07, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-[(1S)-3-chloro-1-phenylpropyl]-2,3-dihydroindole is sourced from PubChem (CID 88990099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).