C11H25NO4S — CID 88991732
N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]-N-methylmethanesulfonamide (PubChem CID 88991732) has the molecular formula C11H25NO4S and a molecular weight of 267.39 g/mol. Its IUPAC name is N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]-N-methylmethanesulfonamide.
| Compound Name | N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 88991732 |
| Molecular Formula | C11H25NO4S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-[2-(3,3-dimethylbutan-2-yloxy)-2-methoxyethyl]-N-methylmethanesulfonamide |
| SMILES | COC(CN(C)S(C)(=O)=O)OC(C)C(C)(C)C |
| InChI | InChI=1S/C11H25NO4S/c1-9(11(2,3)4)16-10(15-6)8-12(5)17(7,13)14/h9-10H,8H2,1-7H3 |
| InChIKey | UFBDBPKBASZUOK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|