C20H18F3N3O5S — CID 88996352
[4-[1-methyl-5-(1-phenylethoxycarbonylamino)pyrazol-4-yl]phenyl] trifluoromethanesulfonate (PubChem CID 88996352) has the molecular formula C20H18F3N3O5S and a molecular weight of 469.44 g/mol. Its IUPAC name is [4-[1-methyl-5-(1-phenylethoxycarbonylamino)pyrazol-4-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[1-methyl-5-(1-phenylethoxycarbonylamino)pyrazol-4-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88996352 |
| Molecular Formula | C20H18F3N3O5S |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | [4-[1-methyl-5-(1-phenylethoxycarbonylamino)pyrazol-4-yl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(OC(=O)Nc1c(-c2ccc(OS(=O)(=O)C(F)(F)F)cc2)cnn1C)c1ccccc1 |
| InChI | InChI=1S/C20H18F3N3O5S/c1-13(14-6-4-3-5-7-14)30-19(27)25-18-17(12-24-26(18)2)15-8-10-16(11-9-15)31-32(28,29)20(21,22)23/h3-13H,1-2H3,(H,25,27) |
| InChIKey | QUDRQNKKMBQTRZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|