C16H20N4O2S — CID 88996925
1-[2-(cyclopropylmethoxy)ethyl]-3-(4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)urea (PubChem CID 88996925) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethoxy)ethyl]-3-(4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-(4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 88996925 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-(4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1nc(NC(=O)NCCOCC2CC2)sc1-c1cccnc1 |
| InChI | InChI=1S/C16H20N4O2S/c1-11-14(13-3-2-6-17-9-13)23-16(19-11)20-15(21)18-7-8-22-10-12-4-5-12/h2-3,6,9,12H,4-5,7-8,10H2,1H3,(H2,18,19,20,21) |
| InChIKey | PPSRZMGZWYUCMR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|