C21H29N3O3S — CID 91592460
1-[2-(cyclopropylmethoxy)ethyl]-3-[5-(3-ethylidene-6-methoxyhept-4-en-1-ynyl)-4-methyl-1,3-thiazol-2-yl]urea (PubChem CID 91592460) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethoxy)ethyl]-3-[5-(3-ethylidene-6-methoxyhept-4-en-1-ynyl)-4-methyl-1,3-thiazol-2-yl]urea.
| Compound Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-[5-(3-ethylidene-6-methoxyhept-4-en-1-ynyl)-4-methyl-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 91592460 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-[5-(3-ethylidene-6-methoxyhept-4-en-1-ynyl)-4-methyl-1,3-thiazol-2-yl]urea |
| SMILES | CC=C(C#Cc1sc(NC(=O)NCCOCC2CC2)nc1C)C=CC(C)OC |
| InChI | InChI=1S/C21H29N3O3S/c1-5-17(7-6-15(2)26-4)10-11-19-16(3)23-21(28-19)24-20(25)22-12-13-27-14-18-8-9-18/h5-7,15,18H,8-9,12-14H2,1-4H3,(H2,22,23,24,25) |
| InChIKey | KYEHGQKDELHXKD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|