C22H23N5O2S — CID 59615711
1-[(2S)-2-(cyclopropylmethoxy)propyl]-3-[4-methyl-5-(2-quinoxalin-6-ylethynyl)-1,3-thiazol-2-yl]urea (PubChem CID 59615711) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is 1-[(2S)-2-(cyclopropylmethoxy)propyl]-3-[4-methyl-5-(2-quinoxalin-6-ylethynyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-[(2S)-2-(cyclopropylmethoxy)propyl]-3-[4-methyl-5-(2-quinoxalin-6-ylethynyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 59615711 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 1-[(2S)-2-(cyclopropylmethoxy)propyl]-3-[4-methyl-5-(2-quinoxalin-6-ylethynyl)-1,3-thiazol-2-yl]urea |
| SMILES | Cc1nc(NC(=O)NC[C@H](C)OCC2CC2)sc1C#Cc1ccc2nccnc2c1 |
| InChI | InChI=1S/C22H23N5O2S/c1-14(29-13-17-3-4-17)12-25-21(28)27-22-26-15(2)20(30-22)8-6-16-5-7-18-19(11-16)24-10-9-23-18/h5,7,9-11,14,17H,3-4,12-13H2,1-2H3,(H2,25,26,27,28)/t14-/m0/s1 |
| InChIKey | WXALRXVPSCUYKG-AWEZNQCLSA-N |
| XLogP | 3.73 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|