C17H23N5O4S — CID 88996815
1-[2-(cyclopropylmethoxy)ethyl]-3-[5-(5,6-dimethoxypyrazin-2-yl)-4-methyl-1,3-thiazol-2-yl]urea (PubChem CID 88996815) has the molecular formula C17H23N5O4S and a molecular weight of 393.47 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethoxy)ethyl]-3-[5-(5,6-dimethoxypyrazin-2-yl)-4-methyl-1,3-thiazol-2-yl]urea.
| Compound Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-[5-(5,6-dimethoxypyrazin-2-yl)-4-methyl-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 88996815 |
| Molecular Formula | C17H23N5O4S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-[5-(5,6-dimethoxypyrazin-2-yl)-4-methyl-1,3-thiazol-2-yl]urea |
| SMILES | COc1ncc(-c2sc(NC(=O)NCCOCC3CC3)nc2C)nc1OC |
| InChI | InChI=1S/C17H23N5O4S/c1-10-13(12-8-19-14(24-2)15(21-12)25-3)27-17(20-10)22-16(23)18-6-7-26-9-11-4-5-11/h8,11H,4-7,9H2,1-3H3,(H2,18,20,22,23) |
| InChIKey | AOHHRRINNWGSPZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|