C18H22N4O2S — CID 91468409
3-methoxy-N-[4-methyl-5-[(Z)-3-methylidene-5-(propan-2-ylideneamino)pent-4-en-1-ynyl]-1,3-thiazol-2-yl]azetidine-1-carboxamide (PubChem CID 91468409) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 3-methoxy-N-[4-methyl-5-[(Z)-3-methylidene-5-(propan-2-ylideneamino)pent-4-en-1-ynyl]-1,3-thiazol-2-yl]azetidine-1-carboxamide.
| Compound Name | 3-methoxy-N-[4-methyl-5-[(Z)-3-methylidene-5-(propan-2-ylideneamino)pent-4-en-1-ynyl]-1,3-thiazol-2-yl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 91468409 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 3-methoxy-N-[4-methyl-5-[(Z)-3-methylidene-5-(propan-2-ylideneamino)pent-4-en-1-ynyl]-1,3-thiazol-2-yl]azetidine-1-carboxamide |
| SMILES | C=C(C#Cc1sc(NC(=O)N2CC(OC)C2)nc1C)/C=C\N=C(C)C |
| InChI | InChI=1S/C18H22N4O2S/c1-12(2)19-9-8-13(3)6-7-16-14(4)20-17(25-16)21-18(23)22-10-15(11-22)24-5/h8-9,15H,3,10-11H2,1-2,4-5H3,(H,20,21,23)/b9-8- |
| InChIKey | DKHCPXXUQWRUNE-HJWRWDBZSA-N |
| XLogP | 3.22 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|