C24H29F2N5OS — CID 91224107
1-[2-[1-(2,2-difluoroethyl)imidazol-4-yl]ethyl]-3-[5-(3-ethylidene-7-methylnona-4,6-dien-1-ynyl)-4-methyl-1,3-thiazol-2-yl]urea (PubChem CID 91224107) has the molecular formula C24H29F2N5OS and a molecular weight of 473.59 g/mol. Its IUPAC name is 1-[2-[1-(2,2-difluoroethyl)imidazol-4-yl]ethyl]-3-[5-(3-ethylidene-7-methylnona-4,6-dien-1-ynyl)-4-methyl-1,3-thiazol-2-yl]urea.
| Compound Name | 1-[2-[1-(2,2-difluoroethyl)imidazol-4-yl]ethyl]-3-[5-(3-ethylidene-7-methylnona-4,6-dien-1-ynyl)-4-methyl-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 91224107 |
| Molecular Formula | C24H29F2N5OS |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 1-[2-[1-(2,2-difluoroethyl)imidazol-4-yl]ethyl]-3-[5-(3-ethylidene-7-methylnona-4,6-dien-1-ynyl)-4-methyl-1,3-thiazol-2-yl]urea |
| SMILES | CC=C(C#Cc1sc(NC(=O)NCCc2cn(CC(F)F)cn2)nc1C)C=CC=C(C)CC |
| InChI | InChI=1S/C24H29F2N5OS/c1-5-17(3)8-7-9-19(6-2)10-11-21-18(4)29-24(33-21)30-23(32)27-13-12-20-14-31(16-28-20)15-22(25)26/h6-9,14,16,22H,5,12-13,15H2,1-4H3,(H2,27,29,30,32) |
| InChIKey | WXZOAHOHGUMMDQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|