C17H20F2N2O2 — CID 89000833
2,5-difluoro-N-[(1-methylcyclohexyl)methyl]-6-prop-2-ynoxypyridine-3-carboxamide (PubChem CID 89000833) has the molecular formula C17H20F2N2O2 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2,5-difluoro-N-[(1-methylcyclohexyl)methyl]-6-prop-2-ynoxypyridine-3-carboxamide.
| Compound Name | 2,5-difluoro-N-[(1-methylcyclohexyl)methyl]-6-prop-2-ynoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 89000833 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2,5-difluoro-N-[(1-methylcyclohexyl)methyl]-6-prop-2-ynoxypyridine-3-carboxamide |
| SMILES | C#CCOc1nc(F)c(C(=O)NCC2(C)CCCCC2)cc1F |
| InChI | InChI=1S/C17H20F2N2O2/c1-3-9-23-16-13(18)10-12(14(19)21-16)15(22)20-11-17(2)7-5-4-6-8-17/h1,10H,4-9,11H2,2H3,(H,20,22) |
| InChIKey | XZIHRZABWVHYMY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|